C21H20F3N5O — CID 21105184
(4-benzylpiperazin-1-yl)-[1-pyridin-2-yl-5-(trifluoromethyl)pyrazol-4-yl]methanone (PubChem CID 21105184) has the molecular formula C21H20F3N5O and a molecular weight of 415.42 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[1-pyridin-2-yl-5-(trifluoromethyl)pyrazol-4-yl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[1-pyridin-2-yl-5-(trifluoromethyl)pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 21105184 |
| Molecular Formula | C21H20F3N5O |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[1-pyridin-2-yl-5-(trifluoromethyl)pyrazol-4-yl]methanone |
| SMILES | O=C(c1cnn(-c2ccccn2)c1C(F)(F)F)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H20F3N5O/c22-21(23,24)19-17(14-26-29(19)18-8-4-5-9-25-18)20(30)28-12-10-27(11-13-28)15-16-6-2-1-3-7-16/h1-9,14H,10-13,15H2 |
| InChIKey | XLTREXBPNOCGDT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |