C15H22FN3O2 — CID 21105637
[1-[2-fluoro-4-(propan-2-ylamino)phenyl]pyrrolidin-3-yl]methylcarbamic acid (PubChem CID 21105637) has the molecular formula C15H22FN3O2 and a molecular weight of 295.36 g/mol. Its IUPAC name is [1-[2-fluoro-4-(propan-2-ylamino)phenyl]pyrrolidin-3-yl]methylcarbamic acid.
| Compound Name | [1-[2-fluoro-4-(propan-2-ylamino)phenyl]pyrrolidin-3-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 21105637 |
| Molecular Formula | C15H22FN3O2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | [1-[2-fluoro-4-(propan-2-ylamino)phenyl]pyrrolidin-3-yl]methylcarbamic acid |
| SMILES | CC(C)Nc1ccc(N2CCC(CNC(=O)O)C2)c(F)c1 |
| InChI | InChI=1S/C15H22FN3O2/c1-10(2)18-12-3-4-14(13(16)7-12)19-6-5-11(9-19)8-17-15(20)21/h3-4,7,10-11,17-18H,5-6,8-9H2,1-2H3,(H,20,21) |
| InChIKey | QBQFWTUPXDFRRG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|