About 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride
4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride (PubChem CID 21105817) has the molecular formula C10H11Cl2N2ReS-
and a molecular weight of 448.39 g/mol. Its IUPAC name is 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride |
| PubChem CID | 21105817 |
| Molecular Formula | C10H11Cl2N2ReS- |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.96 |
| IUPAC Name | 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride |
| SMILES | CNC[CH-]Sc1cc(Cl)ccc1C#N.Cl.[Re] |
| InChI | InChI=1S/C10H10ClN2S.ClH.Re/c1-13-4-5-14-10-6-9(11)3-2-8(10)7-12;;/h2-3,5-6,13H,4H2,1H3;1H;/q-1;; |
| InChIKey | LFUUKJPBCQPGKY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride?
The IUPAC name of 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride (CID 21105817) is 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride.
What is the SMILES notation for 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride?
The canonical SMILES for 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride is CNC[CH-]Sc1cc(Cl)ccc1C#N.Cl.[Re].
What is the InChIKey of 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride?
The InChIKey is LFUUKJPBCQPGKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN2S.ClH.Re/c1-13-4-5-14-10-6-9(11)3-2-8(10)7-12;;/h2-3,5-6,13H,4H2,1H3;1H;/q-1;;.
What are the key properties of 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride?
4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride has a molecular weight of 448.39 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[2-(methylamino)ethylsulfanyl]benzonitrile;rhenium;hydrochloride is sourced from PubChem (CID 21105817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).