C12H28NO4+ — CID 21106306
[2-hydroxy-3-[1-(2-hydroxypropoxy)propan-2-yloxy]propyl]-trimethylazanium (PubChem CID 21106306) has the molecular formula C12H28NO4+ and a molecular weight of 250.36 g/mol. Its IUPAC name is [2-hydroxy-3-[1-(2-hydroxypropoxy)propan-2-yloxy]propyl]-trimethylazanium.
| Compound Name | [2-hydroxy-3-[1-(2-hydroxypropoxy)propan-2-yloxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 21106306 |
| Molecular Formula | C12H28NO4+ |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | [2-hydroxy-3-[1-(2-hydroxypropoxy)propan-2-yloxy]propyl]-trimethylazanium |
| SMILES | CC(O)COCC(C)OCC(O)C[N+](C)(C)C |
| InChI | InChI=1S/C12H28NO4/c1-10(14)7-16-8-11(2)17-9-12(15)6-13(3,4)5/h10-12,14-15H,6-9H2,1-5H3/q+1 |
| InChIKey | UEXCAMMXJVSTHQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|