C22H23N3O4 — CID 21106798
2-[5-[4-methoxy-3-(oxolan-2-yloxy)phenyl]pyrazol-1-yl]-N-phenylacetamide (PubChem CID 21106798) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[5-[4-methoxy-3-(oxolan-2-yloxy)phenyl]pyrazol-1-yl]-N-phenylacetamide.
| Compound Name | 2-[5-[4-methoxy-3-(oxolan-2-yloxy)phenyl]pyrazol-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 21106798 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[5-[4-methoxy-3-(oxolan-2-yloxy)phenyl]pyrazol-1-yl]-N-phenylacetamide |
| SMILES | COc1ccc(-c2ccnn2CC(=O)Nc2ccccc2)cc1OC1CCCO1 |
| InChI | InChI=1S/C22H23N3O4/c1-27-19-10-9-16(14-20(19)29-22-8-5-13-28-22)18-11-12-23-25(18)15-21(26)24-17-6-3-2-4-7-17/h2-4,6-7,9-12,14,22H,5,8,13,15H2,1H3,(H,24,26) |
| InChIKey | YWFNAXAZMNUHMU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |