C24H26N2O5 — CID 21106863
ethyl 1-benzyl-5-[4-methoxy-3-(oxolan-2-yloxy)phenyl]pyrazole-3-carboxylate (PubChem CID 21106863) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is ethyl 1-benzyl-5-[4-methoxy-3-(oxolan-2-yloxy)phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-benzyl-5-[4-methoxy-3-(oxolan-2-yloxy)phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 21106863 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | ethyl 1-benzyl-5-[4-methoxy-3-(oxolan-2-yloxy)phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(OC)c(OC3CCCO3)c2)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C24H26N2O5/c1-3-29-24(27)19-15-20(26(25-19)16-17-8-5-4-6-9-17)18-11-12-21(28-2)22(14-18)31-23-10-7-13-30-23/h4-6,8-9,11-12,14-15,23H,3,7,10,13,16H2,1-2H3 |
| InChIKey | FWURSDLZDSGJRU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |