C22H24N2O3 — CID 11314519
1-benzyl-5-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]-3-methylpyrazole (PubChem CID 11314519) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-benzyl-5-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]-3-methylpyrazole.
| Compound Name | 1-benzyl-5-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]-3-methylpyrazole |
|---|---|
| PubChem CID | 11314519 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-benzyl-5-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]-3-methylpyrazole |
| SMILES | COc1ccc(-c2cc(C)nn2Cc2ccccc2)cc1O[C@H]1CCCO1 |
| InChI | InChI=1S/C22H24N2O3/c1-16-13-19(24(23-16)15-17-7-4-3-5-8-17)18-10-11-20(25-2)21(14-18)27-22-9-6-12-26-22/h3-5,7-8,10-11,13-14,22H,6,9,12,15H2,1-2H3/t22-/m0/s1 |
| InChIKey | POHLXZNMWKLKTC-QFIPXVFZSA-N |
| XLogP | 4.43 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |