C20H20ClN3O3 — CID 11773572
2-chloro-6-[5-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]-3-methylpyrazol-1-yl]pyridine (PubChem CID 11773572) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is 2-chloro-6-[5-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]-3-methylpyrazol-1-yl]pyridine.
| Compound Name | 2-chloro-6-[5-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]-3-methylpyrazol-1-yl]pyridine |
|---|---|
| PubChem CID | 11773572 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-chloro-6-[5-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]-3-methylpyrazol-1-yl]pyridine |
| SMILES | COc1ccc(-c2cc(C)nn2-c2cccc(Cl)n2)cc1O[C@H]1CCCO1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-13-11-15(24(23-13)19-6-3-5-18(21)22-19)14-8-9-16(25-2)17(12-14)27-20-7-4-10-26-20/h3,5-6,8-9,11-12,20H,4,7,10H2,1-2H3/t20-/m0/s1 |
| InChIKey | LXPVRRBLMGXQSZ-FQEVSTJZSA-N |
| XLogP | 4.42 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|