C21H23N3O3 — CID 11257068
4-[[3-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]pyrazol-1-yl]methyl]aniline (PubChem CID 11257068) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[[3-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]pyrazol-1-yl]methyl]aniline.
| Compound Name | 4-[[3-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]pyrazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 11257068 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-[[3-[4-methoxy-3-[(2S)-oxolan-2-yl]oxyphenyl]pyrazol-1-yl]methyl]aniline |
| SMILES | COc1ccc(-c2ccn(Cc3ccc(N)cc3)n2)cc1O[C@H]1CCCO1 |
| InChI | InChI=1S/C21H23N3O3/c1-25-19-9-6-16(13-20(19)27-21-3-2-12-26-21)18-10-11-24(23-18)14-15-4-7-17(22)8-5-15/h4-11,13,21H,2-3,12,14,22H2,1H3/t21-/m0/s1 |
| InChIKey | NOUODAXIOJDTSU-NRFANRHFSA-N |
| XLogP | 3.70 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|