C26H28ClF2N5O2 — CID 21110745
1-[4-[6-amino-5-[1-(2-chloro-3,6-difluorophenyl)ethoxy]-3-pyridinyl]phenyl]-3-(2-pyrrolidin-1-ylethyl)urea (PubChem CID 21110745) has the molecular formula C26H28ClF2N5O2 and a molecular weight of 515.99 g/mol. Its IUPAC name is 1-[4-[6-amino-5-[1-(2-chloro-3,6-difluorophenyl)ethoxy]-3-pyridinyl]phenyl]-3-(2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 1-[4-[6-amino-5-[1-(2-chloro-3,6-difluorophenyl)ethoxy]-3-pyridinyl]phenyl]-3-(2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 21110745 |
| Molecular Formula | C26H28ClF2N5O2 |
| Molecular Weight | 515.99 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 1-[4-[6-amino-5-[1-(2-chloro-3,6-difluorophenyl)ethoxy]-3-pyridinyl]phenyl]-3-(2-pyrrolidin-1-ylethyl)urea |
| SMILES | CC(Oc1cc(-c2ccc(NC(=O)NCCN3CCCC3)cc2)cnc1N)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C26H28ClF2N5O2/c1-16(23-20(28)8-9-21(29)24(23)27)36-22-14-18(15-32-25(22)30)17-4-6-19(7-5-17)33-26(35)31-10-13-34-11-2-3-12-34/h4-9,14-16H,2-3,10-13H2,1H3,(H2,30,32)(H2,31,33,35) |
| InChIKey | AYEAIVKAJGVMMD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.99 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|