C25H26Cl2FN5O2 — CID 21111089
3-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 21111089) has the molecular formula C25H26Cl2FN5O2 and a molecular weight of 518.42 g/mol. Its IUPAC name is 3-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 3-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 21111089 |
| Molecular Formula | C25H26Cl2FN5O2 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 3-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CC(Oc1nc(-c2cccc(C(=O)NC3CCN(C)CC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C25H26Cl2FN5O2/c1-14(21-18(26)6-7-19(28)22(21)27)35-25-23(29)30-13-20(32-25)15-4-3-5-16(12-15)24(34)31-17-8-10-33(2)11-9-17/h3-7,12-14,17H,8-11H2,1-2H3,(H2,29,30)(H,31,34) |
| InChIKey | HRCBXHNJYHKJAX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|