C24H24Cl2FN5O2 — CID 21111098
[3-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 21111098) has the molecular formula C24H24Cl2FN5O2 and a molecular weight of 504.39 g/mol. Its IUPAC name is [3-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [3-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 21111098 |
| Molecular Formula | C24H24Cl2FN5O2 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | [3-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CC(Oc1nc(-c2cccc(C(=O)N3CCN(C)CC3)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C24H24Cl2FN5O2/c1-14(20-17(25)6-7-18(27)21(20)26)34-23-22(28)29-13-19(30-23)15-4-3-5-16(12-15)24(33)32-10-8-31(2)9-11-32/h3-7,12-14H,8-11H2,1-2H3,(H2,28,29) |
| InChIKey | QSUIOALMASVEGK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|