C8H7BrClF3N2O — CID 21114629
5-bromo-2-chloro-4-(4,4,4-trifluorobutoxy)pyrimidine (PubChem CID 21114629) has the molecular formula C8H7BrClF3N2O and a molecular weight of 319.51 g/mol. Its IUPAC name is 5-bromo-2-chloro-4-(4,4,4-trifluorobutoxy)pyrimidine.
| Compound Name | 5-bromo-2-chloro-4-(4,4,4-trifluorobutoxy)pyrimidine |
|---|---|
| PubChem CID | 21114629 |
| Molecular Formula | C8H7BrClF3N2O |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 317.94 |
| IUPAC Name | 5-bromo-2-chloro-4-(4,4,4-trifluorobutoxy)pyrimidine |
| SMILES | FC(F)(F)CCCOc1nc(Cl)ncc1Br |
| InChI | InChI=1S/C8H7BrClF3N2O/c9-5-4-14-7(10)15-6(5)16-3-1-2-8(11,12)13/h4H,1-3H2 |
| InChIKey | UUTAOLFWFKZORC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|