C34H18O17 — CID 21115380
3-[3-carboxy-2-[2-carboxy-6-(2,3-dicarboxybenzoyl)benzoyl]oxycarbonylbenzoyl]phthalic acid (PubChem CID 21115380) has the molecular formula C34H18O17 and a molecular weight of 698.50 g/mol. Its IUPAC name is 3-[3-carboxy-2-[2-carboxy-6-(2,3-dicarboxybenzoyl)benzoyl]oxycarbonylbenzoyl]phthalic acid.
| Compound Name | 3-[3-carboxy-2-[2-carboxy-6-(2,3-dicarboxybenzoyl)benzoyl]oxycarbonylbenzoyl]phthalic acid |
|---|---|
| PubChem CID | 21115380 |
| Molecular Formula | C34H18O17 |
| Molecular Weight | 698.50 g/mol |
| Exact Mass | 698.05 |
| IUPAC Name | 3-[3-carboxy-2-[2-carboxy-6-(2,3-dicarboxybenzoyl)benzoyl]oxycarbonylbenzoyl]phthalic acid |
| SMILES | O=C(O)c1cccc(C(=O)c2cccc(C(=O)O)c2C(=O)OC(=O)c2c(C(=O)O)cccc2C(=O)c2cccc(C(=O)O)c2C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C34H18O17/c35-25(13-5-1-9-17(27(37)38)21(13)31(45)46)15-7-3-11-19(29(41)42)23(15)33(49)51-34(50)24-16(8-4-12-20(24)30(43)44)26(36)14-6-2-10-18(28(39)40)22(14)32(47)48/h1-12H,(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H,45,46)(H,47,48) |
| InChIKey | LSAGBJIDALXOLJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 301.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|