C6H10N2O5 — CID 21119706
3-amino-2-(carboxymethylamino)-2-methyl-3-oxopropanoic acid (PubChem CID 21119706) has the molecular formula C6H10N2O5 and a molecular weight of 190.15 g/mol. Its IUPAC name is 3-amino-2-(carboxymethylamino)-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-amino-2-(carboxymethylamino)-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 21119706 |
| Molecular Formula | C6H10N2O5 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3-amino-2-(carboxymethylamino)-2-methyl-3-oxopropanoic acid |
| SMILES | CC(NCC(=O)O)(C(N)=O)C(=O)O |
| InChI | InChI=1S/C6H10N2O5/c1-6(4(7)11,5(12)13)8-2-3(9)10/h8H,2H2,1H3,(H2,7,11)(H,9,10)(H,12,13) |
| InChIKey | FHPQVWMMVGIRND-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|