C13H14N4O — CID 21121018
1-(4-amino-10-methyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),5,8,10,12-pentaen-3-yl)ethanone (PubChem CID 21121018) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-(4-amino-10-methyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),5,8,10,12-pentaen-3-yl)ethanone.
| Compound Name | 1-(4-amino-10-methyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),5,8,10,12-pentaen-3-yl)ethanone |
|---|---|
| PubChem CID | 21121018 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(4-amino-10-methyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),5,8,10,12-pentaen-3-yl)ethanone |
| SMILES | CC(=O)N1c2c(nc3c(C)cccn23)C=CC1N |
| InChI | InChI=1S/C13H14N4O/c1-8-4-3-7-16-12(8)15-10-5-6-11(14)17(9(2)18)13(10)16/h3-7,11H,14H2,1-2H3 |
| InChIKey | UBVHOTRCESUDKY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |