C12H3Cl4FO2 — CID 21121948
1,2,3,4-tetrachloro-6-fluorodibenzo-p-dioxin (PubChem CID 21121948) has the molecular formula C12H3Cl4FO2 and a molecular weight of 339.96 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-6-fluorodibenzo-p-dioxin.
| Compound Name | 1,2,3,4-tetrachloro-6-fluorodibenzo-p-dioxin |
|---|---|
| PubChem CID | 21121948 |
| Molecular Formula | C12H3Cl4FO2 |
| Molecular Weight | 339.96 g/mol |
| Exact Mass | 337.89 |
| IUPAC Name | 1,2,3,4-tetrachloro-6-fluorodibenzo-p-dioxin |
| SMILES | Fc1cccc2c1Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1O2 |
| InChI | InChI=1S/C12H3Cl4FO2/c13-6-7(14)9(16)12-11(8(6)15)18-5-3-1-2-4(17)10(5)19-12/h1-3H |
| InChIKey | RMJPBDSNOXKWQV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.96 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|