C16H32N4O4-2 — CID 21124417
3-[4-(3-aminopropyl)piperazin-1-yl]propan-1-amine;hexanedioate (PubChem CID 21124417) has the molecular formula C16H32N4O4-2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-[4-(3-aminopropyl)piperazin-1-yl]propan-1-amine;hexanedioate.
| Compound Name | 3-[4-(3-aminopropyl)piperazin-1-yl]propan-1-amine;hexanedioate |
|---|---|
| PubChem CID | 21124417 |
| Molecular Formula | C16H32N4O4-2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 3-[4-(3-aminopropyl)piperazin-1-yl]propan-1-amine;hexanedioate |
| SMILES | NCCCN1CCN(CCCN)CC1.O=C([O-])CCCCC(=O)[O-] |
| InChI | InChI=1S/C10H24N4.C6H10O4/c11-3-1-5-13-7-9-14(10-8-13)6-2-4-12;7-5(8)3-1-2-4-6(9)10/h1-12H2;1-4H2,(H,7,8)(H,9,10)/p-2 |
| InChIKey | ZWPKWMGPJWNIKP-UHFFFAOYSA-L |
| XLogP | -2.65 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|