About 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate
2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate (PubChem CID 21125272) has the molecular formula C12H20NO7P-2
and a molecular weight of 321.27 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate.
Molecular Properties
| Compound Name | 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate |
| PubChem CID | 21125272 |
| Molecular Formula | C12H20NO7P-2 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate |
| SMILES | O=P([O-])([O-])OCCOc1ccccc1.OCCNCCO |
| InChI | InChI=1S/C8H11O5P.C4H11NO2/c9-14(10,11)13-7-6-12-8-4-2-1-3-5-8;6-3-1-5-2-4-7/h1-5H,6-7H2,(H2,9,10,11);5-7H,1-4H2/p-2 |
| InChIKey | VABAWPAYYQNQPT-UHFFFAOYSA-L |
| XLogP | -1.53 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate?
The IUPAC name of 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate (CID 21125272) is 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate.
What is the SMILES notation for 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate?
The canonical SMILES for 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate is O=P([O-])([O-])OCCOc1ccccc1.OCCNCCO.
What is the InChIKey of 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate?
The InChIKey is VABAWPAYYQNQPT-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H11O5P.C4H11NO2/c9-14(10,11)13-7-6-12-8-4-2-1-3-5-8;6-3-1-5-2-4-7/h1-5H,6-7H2,(H2,9,10,11);5-7H,1-4H2/p-2.
What are the key properties of 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate?
2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate has a molecular weight of 321.27 g/mol, XLogP of -1.53, 9 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethylamino)ethanol;2-phenoxyethyl phosphate is sourced from PubChem (CID 21125272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).