C27H40FN3O3 — CID 21127187
cyclohexanone;1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidin-1-ylpiperidine-4-carboxamide (PubChem CID 21127187) has the molecular formula C27H40FN3O3 and a molecular weight of 473.63 g/mol. Its IUPAC name is cyclohexanone;1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidin-1-ylpiperidine-4-carboxamide.
| Compound Name | cyclohexanone;1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidin-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 21127187 |
| Molecular Formula | C27H40FN3O3 |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | cyclohexanone;1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidin-1-ylpiperidine-4-carboxamide |
| SMILES | NC(=O)C1(N2CCCCC2)CCN(CCCC(=O)c2ccc(F)cc2)CC1.O=C1CCCCC1 |
| InChI | InChI=1S/C21H30FN3O2.C6H10O/c22-18-8-6-17(7-9-18)19(26)5-4-12-24-15-10-21(11-16-24,20(23)27)25-13-2-1-3-14-25;7-6-4-2-1-3-5-6/h6-9H,1-5,10-16H2,(H2,23,27);1-5H2 |
| InChIKey | CNHUTJTUXYMKFE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |