C18H36N2O3S2 — CID 21128118
[2-[2-(cyclohexylmethylamino)ethylsulfanylsulfonyloxy]ethylamino]methylcyclohexane (PubChem CID 21128118) has the molecular formula C18H36N2O3S2 and a molecular weight of 392.63 g/mol. Its IUPAC name is [2-[2-(cyclohexylmethylamino)ethylsulfanylsulfonyloxy]ethylamino]methylcyclohexane.
| Compound Name | [2-[2-(cyclohexylmethylamino)ethylsulfanylsulfonyloxy]ethylamino]methylcyclohexane |
|---|---|
| PubChem CID | 21128118 |
| Molecular Formula | C18H36N2O3S2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [2-[2-(cyclohexylmethylamino)ethylsulfanylsulfonyloxy]ethylamino]methylcyclohexane |
| SMILES | O=S(=O)(OCCNCC1CCCCC1)SCCNCC1CCCCC1 |
| InChI | InChI=1S/C18H36N2O3S2/c21-25(22,23-13-11-19-15-17-7-3-1-4-8-17)24-14-12-20-16-18-9-5-2-6-10-18/h17-20H,1-16H2 |
| InChIKey | WODHGNMVRAADMB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|