C20H40N2O3S2 — CID 21128119
2-[2-[2-(2-cyclohexylethylamino)ethylsulfanylsulfonyloxy]ethylamino]ethylcyclohexane (PubChem CID 21128119) has the molecular formula C20H40N2O3S2 and a molecular weight of 420.69 g/mol. Its IUPAC name is 2-[2-[2-(2-cyclohexylethylamino)ethylsulfanylsulfonyloxy]ethylamino]ethylcyclohexane.
| Compound Name | 2-[2-[2-(2-cyclohexylethylamino)ethylsulfanylsulfonyloxy]ethylamino]ethylcyclohexane |
|---|---|
| PubChem CID | 21128119 |
| Molecular Formula | C20H40N2O3S2 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 2-[2-[2-(2-cyclohexylethylamino)ethylsulfanylsulfonyloxy]ethylamino]ethylcyclohexane |
| SMILES | O=S(=O)(OCCNCCC1CCCCC1)SCCNCCC1CCCCC1 |
| InChI | InChI=1S/C20H40N2O3S2/c23-27(24,25-17-15-21-13-11-19-7-3-1-4-8-19)26-18-16-22-14-12-20-9-5-2-6-10-20/h19-22H,1-18H2 |
| InChIKey | HPYUJEGVRSDNGD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|