C26H52N2O3S2 — CID 21117159
1-methyl-4-[4-[2-[2-[4-(4-methylcyclohexyl)butylamino]ethylsulfanylsulfonyloxy]ethylamino]butyl]cyclohexane (PubChem CID 21117159) has the molecular formula C26H52N2O3S2 and a molecular weight of 504.85 g/mol. Its IUPAC name is 1-methyl-4-[4-[2-[2-[4-(4-methylcyclohexyl)butylamino]ethylsulfanylsulfonyloxy]ethylamino]butyl]cyclohexane.
| Compound Name | 1-methyl-4-[4-[2-[2-[4-(4-methylcyclohexyl)butylamino]ethylsulfanylsulfonyloxy]ethylamino]butyl]cyclohexane |
|---|---|
| PubChem CID | 21117159 |
| Molecular Formula | C26H52N2O3S2 |
| Molecular Weight | 504.85 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | 1-methyl-4-[4-[2-[2-[4-(4-methylcyclohexyl)butylamino]ethylsulfanylsulfonyloxy]ethylamino]butyl]cyclohexane |
| SMILES | CC1CCC(CCCCNCCOS(=O)(=O)SCCNCCCCC2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C26H52N2O3S2/c1-23-9-13-25(14-10-23)7-3-5-17-27-19-21-31-33(29,30)32-22-20-28-18-6-4-8-26-15-11-24(2)12-16-26/h23-28H,3-22H2,1-2H3 |
| InChIKey | CTOFGZYYQGDDFW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.85 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|