C28H56N2O3S2 — CID 21128133
1-[4-[2-[2-[4-(2,4-dimethylcyclohexyl)butylamino]ethylsulfanylsulfonyloxy]ethylamino]butyl]-2,4-dimethylcyclohexane (PubChem CID 21128133) has the molecular formula C28H56N2O3S2 and a molecular weight of 532.90 g/mol. Its IUPAC name is 1-[4-[2-[2-[4-(2,4-dimethylcyclohexyl)butylamino]ethylsulfanylsulfonyloxy]ethylamino]butyl]-2,4-dimethylcyclohexane.
| Compound Name | 1-[4-[2-[2-[4-(2,4-dimethylcyclohexyl)butylamino]ethylsulfanylsulfonyloxy]ethylamino]butyl]-2,4-dimethylcyclohexane |
|---|---|
| PubChem CID | 21128133 |
| Molecular Formula | C28H56N2O3S2 |
| Molecular Weight | 532.90 g/mol |
| Exact Mass | 532.37 |
| IUPAC Name | 1-[4-[2-[2-[4-(2,4-dimethylcyclohexyl)butylamino]ethylsulfanylsulfonyloxy]ethylamino]butyl]-2,4-dimethylcyclohexane |
| SMILES | CC1CCC(CCCCNCCOS(=O)(=O)SCCNCCCCC2CCC(C)CC2C)C(C)C1 |
| InChI | InChI=1S/C28H56N2O3S2/c1-23-11-13-27(25(3)21-23)9-5-7-15-29-17-19-33-35(31,32)34-20-18-30-16-8-6-10-28-14-12-24(2)22-26(28)4/h23-30H,5-22H2,1-4H3 |
| InChIKey | NPJUOWCVIAAEHS-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.90 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|