C14H29NS — CID 99945917
2-[4-[(1S,2S,5R)-2,5-dimethylcyclohexyl]butylamino]ethanethiol (PubChem CID 99945917) has the molecular formula C14H29NS and a molecular weight of 243.46 g/mol. Its IUPAC name is 2-[4-[(1S,2S,5R)-2,5-dimethylcyclohexyl]butylamino]ethanethiol.
| Compound Name | 2-[4-[(1S,2S,5R)-2,5-dimethylcyclohexyl]butylamino]ethanethiol |
|---|---|
| PubChem CID | 99945917 |
| Molecular Formula | C14H29NS |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 2-[4-[(1S,2S,5R)-2,5-dimethylcyclohexyl]butylamino]ethanethiol |
| SMILES | C[C@@H]1CC[C@H](C)[C@@H](CCCCNCCS)C1 |
| InChI | InChI=1S/C14H29NS/c1-12-6-7-13(2)14(11-12)5-3-4-8-15-9-10-16/h12-16H,3-11H2,1-2H3/t12-,13+,14+/m1/s1 |
| InChIKey | ZICAUDTZENEANJ-RDBSUJKOSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|