C13H29NO4S2 — CID 71435984
2-[4-(3-methylcyclohexyl)butylamino]ethanethiol;sulfuric acid (PubChem CID 71435984) has the molecular formula C13H29NO4S2 and a molecular weight of 327.51 g/mol. Its IUPAC name is 2-[4-(3-methylcyclohexyl)butylamino]ethanethiol;sulfuric acid.
| Compound Name | 2-[4-(3-methylcyclohexyl)butylamino]ethanethiol;sulfuric acid |
|---|---|
| PubChem CID | 71435984 |
| Molecular Formula | C13H29NO4S2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-[4-(3-methylcyclohexyl)butylamino]ethanethiol;sulfuric acid |
| SMILES | CC1CCCC(CCCCNCCS)C1.O=S(=O)(O)O |
| InChI | InChI=1S/C13H27NS.H2O4S/c1-12-5-4-7-13(11-12)6-2-3-8-14-9-10-15;1-5(2,3)4/h12-15H,2-11H2,1H3;(H2,1,2,3,4) |
| InChIKey | AHWTYIYMDRJOOE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|