C13H27NS — CID 99867871
2-[4-[(1R,3R)-3-methylcyclohexyl]butylamino]ethanethiol (PubChem CID 99867871) has the molecular formula C13H27NS and a molecular weight of 229.43 g/mol. Its IUPAC name is 2-[4-[(1R,3R)-3-methylcyclohexyl]butylamino]ethanethiol.
| Compound Name | 2-[4-[(1R,3R)-3-methylcyclohexyl]butylamino]ethanethiol |
|---|---|
| PubChem CID | 99867871 |
| Molecular Formula | C13H27NS |
| Molecular Weight | 229.43 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | 2-[4-[(1R,3R)-3-methylcyclohexyl]butylamino]ethanethiol |
| SMILES | C[C@@H]1CCC[C@H](CCCCNCCS)C1 |
| InChI | InChI=1S/C13H27NS/c1-12-5-4-7-13(11-12)6-2-3-8-14-9-10-15/h12-15H,2-11H2,1H3/t12-,13+/m1/s1 |
| InChIKey | JCVBAPJBPOEJSK-OLZOCXBDSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|