C16H33NO4S2 — CID 91799099
2-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)butylamino]ethanethiol;sulfuric acid (PubChem CID 91799099) has the molecular formula C16H33NO4S2 and a molecular weight of 367.58 g/mol. Its IUPAC name is 2-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)butylamino]ethanethiol;sulfuric acid.
| Compound Name | 2-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)butylamino]ethanethiol;sulfuric acid |
|---|---|
| PubChem CID | 91799099 |
| Molecular Formula | C16H33NO4S2 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-[4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)butylamino]ethanethiol;sulfuric acid |
| SMILES | O=S(=O)(O)O.SCCNCCCCC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H31NS.H2O4S/c18-12-11-17-10-4-3-5-14-8-9-15-6-1-2-7-16(15)13-14;1-5(2,3)4/h14-18H,1-13H2;(H2,1,2,3,4) |
| InChIKey | QMRZNANTLAPSIV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|