C12H20N2O5 — CID 21128373
oxalic acid;N-(1-prop-2-enylpyrrolidin-3-yl)propanamide (PubChem CID 21128373) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is oxalic acid;N-(1-prop-2-enylpyrrolidin-3-yl)propanamide.
| Compound Name | oxalic acid;N-(1-prop-2-enylpyrrolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 21128373 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | oxalic acid;N-(1-prop-2-enylpyrrolidin-3-yl)propanamide |
| SMILES | C=CCN1CCC(NC(=O)CC)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H18N2O.C2H2O4/c1-3-6-12-7-5-9(8-12)11-10(13)4-2;3-1(4)2(5)6/h3,9H,1,4-8H2,2H3,(H,11,13);(H,3,4)(H,5,6) |
| InChIKey | HBLMVNMPOMKELJ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|