C27H52N4O5 — CID 21130745
N,N'-bis[4-(butanoylamino)butyl]-2-(6-ethoxyhexyl)propanediamide (PubChem CID 21130745) has the molecular formula C27H52N4O5 and a molecular weight of 512.74 g/mol. Its IUPAC name is N,N'-bis[4-(butanoylamino)butyl]-2-(6-ethoxyhexyl)propanediamide.
| Compound Name | N,N'-bis[4-(butanoylamino)butyl]-2-(6-ethoxyhexyl)propanediamide |
|---|---|
| PubChem CID | 21130745 |
| Molecular Formula | C27H52N4O5 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | N,N'-bis[4-(butanoylamino)butyl]-2-(6-ethoxyhexyl)propanediamide |
| SMILES | CCCC(=O)NCCCCNC(=O)C(CCCCCCOCC)C(=O)NCCCCNC(=O)CCC |
| InChI | InChI=1S/C27H52N4O5/c1-4-15-24(32)28-18-10-12-20-30-26(34)23(17-9-7-8-14-22-36-6-3)27(35)31-21-13-11-19-29-25(33)16-5-2/h23H,4-22H2,1-3H3,(H,28,32)(H,29,33)(H,30,34)(H,31,35) |
| InChIKey | AIOWCWKKQXOWRT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|