C24H28ClN3O3S — CID 21133017
5-chloro-N-[2-(diethylamino)ethyl]-2-methyl-4-(naphthalen-1-ylsulfonylamino)benzamide (PubChem CID 21133017) has the molecular formula C24H28ClN3O3S and a molecular weight of 474.03 g/mol. Its IUPAC name is 5-chloro-N-[2-(diethylamino)ethyl]-2-methyl-4-(naphthalen-1-ylsulfonylamino)benzamide.
| Compound Name | 5-chloro-N-[2-(diethylamino)ethyl]-2-methyl-4-(naphthalen-1-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 21133017 |
| Molecular Formula | C24H28ClN3O3S |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 5-chloro-N-[2-(diethylamino)ethyl]-2-methyl-4-(naphthalen-1-ylsulfonylamino)benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(Cl)c(NS(=O)(=O)c2cccc3ccccc23)cc1C |
| InChI | InChI=1S/C24H28ClN3O3S/c1-4-28(5-2)14-13-26-24(29)20-16-21(25)22(15-17(20)3)27-32(30,31)23-12-8-10-18-9-6-7-11-19(18)23/h6-12,15-16,27H,4-5,13-14H2,1-3H3,(H,26,29) |
| InChIKey | SLCUAUSEBFIZSI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |