About disodium;2-amino-2-sulfinatoacetate
disodium;2-amino-2-sulfinatoacetate (PubChem CID 21133292) has the molecular formula C2H3NNa2O4S
and a molecular weight of 183.10 g/mol. Its IUPAC name is disodium;2-amino-2-sulfinatoacetate.
Molecular Properties
| Compound Name | disodium;2-amino-2-sulfinatoacetate |
| PubChem CID | 21133292 |
| Molecular Formula | C2H3NNa2O4S |
| Molecular Weight | 183.10 g/mol |
| Exact Mass | 182.96 |
| IUPAC Name | disodium;2-amino-2-sulfinatoacetate |
| SMILES | NC(C(=O)[O-])S(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C2H5NO4S.2Na/c3-1(2(4)5)8(6)7;;/h1H,3H2,(H,4,5)(H,6,7);;/q;2*+1/p-2 |
| InChIKey | OEBPDJSUBBLQNJ-UHFFFAOYSA-L |
| XLogP | -9.09 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.10 |
| LogP ≤ 5 | -9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-amino-2-sulfinatoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-amino-2-sulfinatoacetate?
The IUPAC name of disodium;2-amino-2-sulfinatoacetate (CID 21133292) is disodium;2-amino-2-sulfinatoacetate.
What is the SMILES notation for disodium;2-amino-2-sulfinatoacetate?
The canonical SMILES for disodium;2-amino-2-sulfinatoacetate is NC(C(=O)[O-])S(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-amino-2-sulfinatoacetate?
The InChIKey is OEBPDJSUBBLQNJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H5NO4S.2Na/c3-1(2(4)5)8(6)7;;/h1H,3H2,(H,4,5)(H,6,7);;/q;2*+1/p-2.
What are the key properties of disodium;2-amino-2-sulfinatoacetate?
disodium;2-amino-2-sulfinatoacetate has a molecular weight of 183.10 g/mol, XLogP of -9.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-amino-2-sulfinatoacetate is sourced from PubChem (CID 21133292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).