C17H30O6 — CID 21134944
1-O-(2,2-dimethylbutanoyloxymethyl) 5-O-methyl 4-ethyl-2,2-dimethylpentanedioate (PubChem CID 21134944) has the molecular formula C17H30O6 and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-O-(2,2-dimethylbutanoyloxymethyl) 5-O-methyl 4-ethyl-2,2-dimethylpentanedioate.
| Compound Name | 1-O-(2,2-dimethylbutanoyloxymethyl) 5-O-methyl 4-ethyl-2,2-dimethylpentanedioate |
|---|---|
| PubChem CID | 21134944 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 1-O-(2,2-dimethylbutanoyloxymethyl) 5-O-methyl 4-ethyl-2,2-dimethylpentanedioate |
| SMILES | CCC(CC(C)(C)C(=O)OCOC(=O)C(C)(C)CC)C(=O)OC |
| InChI | InChI=1S/C17H30O6/c1-8-12(13(18)21-7)10-17(5,6)15(20)23-11-22-14(19)16(3,4)9-2/h12H,8-11H2,1-7H3 |
| InChIKey | CFZQZBXHUGXGTA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|