C8H16O6P2 — CID 21136343
3-ethoxy-9-methoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 21136343) has the molecular formula C8H16O6P2 and a molecular weight of 270.16 g/mol. Its IUPAC name is 3-ethoxy-9-methoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3-ethoxy-9-methoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 21136343 |
| Molecular Formula | C8H16O6P2 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3-ethoxy-9-methoxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | CCOP1OCC2(COP(OC)OC2)CO1 |
| InChI | InChI=1S/C8H16O6P2/c1-3-10-16-13-6-8(7-14-16)4-11-15(9-2)12-5-8/h3-7H2,1-2H3 |
| InChIKey | ONJRNYKISXEVQD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|