C7H10F2N2 — CID 21136569
1-(difluoromethyl)-3,4,5-trimethylpyrazole (PubChem CID 21136569) has the molecular formula C7H10F2N2 and a molecular weight of 160.17 g/mol. Its IUPAC name is 1-(difluoromethyl)-3,4,5-trimethylpyrazole.
| Compound Name | 1-(difluoromethyl)-3,4,5-trimethylpyrazole |
|---|---|
| PubChem CID | 21136569 |
| Molecular Formula | C7H10F2N2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 1-(difluoromethyl)-3,4,5-trimethylpyrazole |
| SMILES | Cc1nn(C(F)F)c(C)c1C |
| InChI | InChI=1S/C7H10F2N2/c1-4-5(2)10-11(6(4)3)7(8)9/h7H,1-3H3 |
| InChIKey | ZACREQITRUEDAW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |