C28H56N6O2 — CID 21136886
3,3,5,5-tetramethyl-1-[2-[6-[1-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)propan-2-ylamino]hexylamino]propyl]piperazin-2-one (PubChem CID 21136886) has the molecular formula C28H56N6O2 and a molecular weight of 508.80 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-[2-[6-[1-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)propan-2-ylamino]hexylamino]propyl]piperazin-2-one.
| Compound Name | 3,3,5,5-tetramethyl-1-[2-[6-[1-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)propan-2-ylamino]hexylamino]propyl]piperazin-2-one |
|---|---|
| PubChem CID | 21136886 |
| Molecular Formula | C28H56N6O2 |
| Molecular Weight | 508.80 g/mol |
| Exact Mass | 508.45 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-[2-[6-[1-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)propan-2-ylamino]hexylamino]propyl]piperazin-2-one |
| SMILES | CC(CN1CC(C)(C)NC(C)(C)C1=O)NCCCCCCNC(C)CN1CC(C)(C)NC(C)(C)C1=O |
| InChI | InChI=1S/C28H56N6O2/c1-21(17-33-19-25(3,4)31-27(7,8)23(33)35)29-15-13-11-12-14-16-30-22(2)18-34-20-26(5,6)32-28(9,10)24(34)36/h21-22,29-32H,11-20H2,1-10H3 |
| InChIKey | UNZBZXXGWKDMLF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.80 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|