C10H16N2O2 — CID 21137416
1-methyl-5-morpholin-4-yl-2,3-dihydropyridin-6-one (PubChem CID 21137416) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-methyl-5-morpholin-4-yl-2,3-dihydropyridin-6-one.
| Compound Name | 1-methyl-5-morpholin-4-yl-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 21137416 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-methyl-5-morpholin-4-yl-2,3-dihydropyridin-6-one |
| SMILES | CN1CCC=C(N2CCOCC2)C1=O |
| InChI | InChI=1S/C10H16N2O2/c1-11-4-2-3-9(10(11)13)12-5-7-14-8-6-12/h3H,2,4-8H2,1H3 |
| InChIKey | MVMSKOJRJCHOQD-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |