C11H17N3O2 — CID 89385287
4-(1-methyl-2,3-dihydropyrrole-5-carbonyl)piperazine-1-carbaldehyde (PubChem CID 89385287) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-(1-methyl-2,3-dihydropyrrole-5-carbonyl)piperazine-1-carbaldehyde.
| Compound Name | 4-(1-methyl-2,3-dihydropyrrole-5-carbonyl)piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 89385287 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 4-(1-methyl-2,3-dihydropyrrole-5-carbonyl)piperazine-1-carbaldehyde |
| SMILES | CN1CCC=C1C(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C11H17N3O2/c1-12-4-2-3-10(12)11(16)14-7-5-13(9-15)6-8-14/h3,9H,2,4-8H2,1H3 |
| InChIKey | ILZKKSNXYHQOPI-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|