C21H26O3S — CID 21137925
ethyl (2E,4E)-5-(7-methoxy-3,3-dimethyl-2H-1-benzothiepin-5-yl)-3-methylpenta-2,4-dienoate (PubChem CID 21137925) has the molecular formula C21H26O3S and a molecular weight of 358.50 g/mol. Its IUPAC name is ethyl (2E,4E)-5-(7-methoxy-3,3-dimethyl-2H-1-benzothiepin-5-yl)-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-(7-methoxy-3,3-dimethyl-2H-1-benzothiepin-5-yl)-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 21137925 |
| Molecular Formula | C21H26O3S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | ethyl (2E,4E)-5-(7-methoxy-3,3-dimethyl-2H-1-benzothiepin-5-yl)-3-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C1=CC(C)(C)CSc2ccc(OC)cc21 |
| InChI | InChI=1S/C21H26O3S/c1-6-24-20(22)11-15(2)7-8-16-13-21(3,4)14-25-19-10-9-17(23-5)12-18(16)19/h7-13H,6,14H2,1-5H3/b8-7+,15-11+ |
| InChIKey | CRPZGAACHLDBBK-XHBXSBNISA-N |
| XLogP | 5.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|