C18H20O3S — CID 59077156
(2E,4E)-5-(6-methoxy-2,2-dimethylthiochromen-4-yl)-3-methylpenta-2,4-dienoic acid (PubChem CID 59077156) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is (2E,4E)-5-(6-methoxy-2,2-dimethylthiochromen-4-yl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(6-methoxy-2,2-dimethylthiochromen-4-yl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 59077156 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2E,4E)-5-(6-methoxy-2,2-dimethylthiochromen-4-yl)-3-methylpenta-2,4-dienoic acid |
| SMILES | COc1ccc2c(c1)C(/C=C/C(C)=C/C(=O)O)=CC(C)(C)S2 |
| InChI | InChI=1S/C18H20O3S/c1-12(9-17(19)20)5-6-13-11-18(2,3)22-16-8-7-14(21-4)10-15(13)16/h5-11H,1-4H3,(H,19,20)/b6-5+,12-9+ |
| InChIKey | MTFQYKZMZUVYTQ-HFACTSAFSA-N |
| XLogP | 4.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|