About sodium naphthalen-1-yl hydrogen phosphate
sodium naphthalen-1-yl hydrogen phosphate (PubChem CID 2114) has the molecular formula C10H8NaO4P
and a molecular weight of 246.13 g/mol. Its IUPAC name is sodium naphthalen-1-yl hydrogen phosphate.
Molecular Properties
| Compound Name | sodium naphthalen-1-yl hydrogen phosphate |
| PubChem CID | 2114 |
| Molecular Formula | C10H8NaO4P |
| Molecular Weight | 246.13 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | sodium naphthalen-1-yl hydrogen phosphate |
| SMILES | O=P([O-])(O)Oc1cccc2ccccc12.[Na+] |
| InChI | InChI=1S/C10H9O4P.Na/c11-15(12,13)14-10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H,(H2,11,12,13);/q;+1/p-1 |
| InChIKey | DELRLFMUZXCKAR-UHFFFAOYSA-M |
| XLogP | -1.32 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.13 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium naphthalen-1-yl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium naphthalen-1-yl hydrogen phosphate?
The IUPAC name of sodium naphthalen-1-yl hydrogen phosphate (CID 2114) is sodium naphthalen-1-yl hydrogen phosphate.
What is the SMILES notation for sodium naphthalen-1-yl hydrogen phosphate?
The canonical SMILES for sodium naphthalen-1-yl hydrogen phosphate is O=P([O-])(O)Oc1cccc2ccccc12.[Na+].
What is the InChIKey of sodium naphthalen-1-yl hydrogen phosphate?
The InChIKey is DELRLFMUZXCKAR-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9O4P.Na/c11-15(12,13)14-10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H,(H2,11,12,13);/q;+1/p-1.
What are the key properties of sodium naphthalen-1-yl hydrogen phosphate?
sodium naphthalen-1-yl hydrogen phosphate has a molecular weight of 246.13 g/mol, XLogP of -1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium naphthalen-1-yl hydrogen phosphate is sourced from PubChem (CID 2114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).