About CID 21144076
CID 21144076 (PubChem CID 21144076) has the molecular formula C12H12N3
and a molecular weight of 198.25 g/mol.
Molecular Properties
| Compound Name | CID 21144076 |
| PubChem CID | 21144076 |
| Molecular Formula | C12H12N3 |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | — |
| SMILES | Nc1ccccc1[N]c1ccccc1N |
| InChI | InChI=1S/C12H12N3/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14/h1-8H,13-14H2 |
| InChIKey | JPRUKNZZGBEBBE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze CID 21144076 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21144076?
The IUPAC name of CID 21144076 (CID 21144076) is not available.
What is the SMILES notation for CID 21144076?
The canonical SMILES for CID 21144076 is Nc1ccccc1[N]c1ccccc1N.
What is the InChIKey of CID 21144076?
The InChIKey is JPRUKNZZGBEBBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N3/c13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14/h1-8H,13-14H2.
What are the key properties of CID 21144076?
CID 21144076 has a molecular weight of 198.25 g/mol, XLogP of 2.42, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21144076 is sourced from PubChem (CID 21144076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).