C3H6O9PS- — CID 21145203
(2R)-2-hydroxy-2-phosphono-3-sulfopropanoate (PubChem CID 21145203) has the molecular formula C3H6O9PS- and a molecular weight of 249.11 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-phosphono-3-sulfopropanoate.
| Compound Name | (2R)-2-hydroxy-2-phosphono-3-sulfopropanoate |
|---|---|
| PubChem CID | 21145203 |
| Molecular Formula | C3H6O9PS- |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 248.95 |
| IUPAC Name | (2R)-2-hydroxy-2-phosphono-3-sulfopropanoate |
| SMILES | O=C([O-])[C@](O)(CS(=O)(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C3H7O9PS/c4-2(5)3(6,13(7,8)9)1-14(10,11)12/h6H,1H2,(H,4,5)(H2,7,8,9)(H,10,11,12)/p-1/t3-/m0/s1 |
| InChIKey | XPJHIDLYCJYRKI-VKHMYHEASA-M |
| XLogP | -3.51 |
| TPSA | 172.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|