C32H49N5O — CID 21147119
7-[2-(6-aminododecylamino)-5-methylimidazo[1,5-b]pyridazin-7-yl]-1-phenylheptan-1-one (PubChem CID 21147119) has the molecular formula C32H49N5O and a molecular weight of 519.78 g/mol. Its IUPAC name is 7-[2-(6-aminododecylamino)-5-methylimidazo[1,5-b]pyridazin-7-yl]-1-phenylheptan-1-one.
| Compound Name | 7-[2-(6-aminododecylamino)-5-methylimidazo[1,5-b]pyridazin-7-yl]-1-phenylheptan-1-one |
|---|---|
| PubChem CID | 21147119 |
| Molecular Formula | C32H49N5O |
| Molecular Weight | 519.78 g/mol |
| Exact Mass | 519.39 |
| IUPAC Name | 7-[2-(6-aminododecylamino)-5-methylimidazo[1,5-b]pyridazin-7-yl]-1-phenylheptan-1-one |
| SMILES | CCCCCCC(N)CCCCCNc1ccc2c(C)nc(CCCCCCC(=O)c3ccccc3)n2n1 |
| InChI | InChI=1S/C32H49N5O/c1-3-4-5-12-19-28(33)20-13-9-16-25-34-31-24-23-29-26(2)35-32(37(29)36-31)22-15-7-6-14-21-30(38)27-17-10-8-11-18-27/h8,10-11,17-18,23-24,28H,3-7,9,12-16,19-22,25,33H2,1-2H3,(H,34,36) |
| InChIKey | XMEXNBRSWVMKFO-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.78 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|