C22H24N6O — CID 164667947
7-[1-methyl-7-(triazol-1-yl)imidazo[1,5-c]pyrimidin-3-yl]-1-phenylheptan-1-one (PubChem CID 164667947) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 7-[1-methyl-7-(triazol-1-yl)imidazo[1,5-c]pyrimidin-3-yl]-1-phenylheptan-1-one.
| Compound Name | 7-[1-methyl-7-(triazol-1-yl)imidazo[1,5-c]pyrimidin-3-yl]-1-phenylheptan-1-one |
|---|---|
| PubChem CID | 164667947 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 7-[1-methyl-7-(triazol-1-yl)imidazo[1,5-c]pyrimidin-3-yl]-1-phenylheptan-1-one |
| SMILES | Cc1nc(CCCCCCC(=O)c2ccccc2)n2cnc(-n3ccnn3)cc12 |
| InChI | InChI=1S/C22H24N6O/c1-17-19-15-22(28-14-13-24-26-28)23-16-27(19)21(25-17)12-8-3-2-7-11-20(29)18-9-5-4-6-10-18/h4-6,9-10,13-16H,2-3,7-8,11-12H2,1H3 |
| InChIKey | RLNQMMUPSIFUGJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|