C21H19NO4S2 — CID 21147161
[4-[(2R,3R)-5-benzylsulfanyl-7-oxo-6-thia-4-azaspiro[2.4]hept-4-en-2-yl]-2-methoxyphenyl] acetate (PubChem CID 21147161) has the molecular formula C21H19NO4S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is [4-[(2R,3R)-5-benzylsulfanyl-7-oxo-6-thia-4-azaspiro[2.4]hept-4-en-2-yl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(2R,3R)-5-benzylsulfanyl-7-oxo-6-thia-4-azaspiro[2.4]hept-4-en-2-yl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 21147161 |
| Molecular Formula | C21H19NO4S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | [4-[(2R,3R)-5-benzylsulfanyl-7-oxo-6-thia-4-azaspiro[2.4]hept-4-en-2-yl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc([C@H]2C[C@@]23N=C(SCc2ccccc2)SC3=O)ccc1OC(C)=O |
| InChI | InChI=1S/C21H19NO4S2/c1-13(23)26-17-9-8-15(10-18(17)25-2)16-11-21(16)19(24)28-20(22-21)27-12-14-6-4-3-5-7-14/h3-10,16H,11-12H2,1-2H3/t16-,21-/m1/s1 |
| InChIKey | ZYQUIMWIPSIIIK-IIBYNOLFSA-N |
| XLogP | 4.41 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|