C20H17NO5 — CID 171987194
[2-methoxy-5-[(2S)-7-oxo-5-phenyl-6-oxa-4-azaspiro[2.4]hept-4-en-2-yl]phenyl] acetate (PubChem CID 171987194) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is [2-methoxy-5-[(2S)-7-oxo-5-phenyl-6-oxa-4-azaspiro[2.4]hept-4-en-2-yl]phenyl] acetate.
| Compound Name | [2-methoxy-5-[(2S)-7-oxo-5-phenyl-6-oxa-4-azaspiro[2.4]hept-4-en-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 171987194 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [2-methoxy-5-[(2S)-7-oxo-5-phenyl-6-oxa-4-azaspiro[2.4]hept-4-en-2-yl]phenyl] acetate |
| SMILES | COc1ccc([C@@H]2CC23N=C(c2ccccc2)OC3=O)cc1OC(C)=O |
| InChI | InChI=1S/C20H17NO5/c1-12(22)25-17-10-14(8-9-16(17)24-2)15-11-20(15)19(23)26-18(21-20)13-6-4-3-5-7-13/h3-10,15H,11H2,1-2H3/t15-,20?/m0/s1 |
| InChIKey | CVDFQRLDLCTZHL-OOJLDXBWSA-N |
| XLogP | 2.85 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|