C21H19ClN6S — CID 21148494
1-[[5-(4-chlorophenyl)-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-1-methylthiourea (PubChem CID 21148494) has the molecular formula C21H19ClN6S and a molecular weight of 422.95 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-1-methylthiourea.
| Compound Name | 1-[[5-(4-chlorophenyl)-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-1-methylthiourea |
|---|---|
| PubChem CID | 21148494 |
| Molecular Formula | C21H19ClN6S |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]-1-methylthiourea |
| SMILES | Cc1ccc(-n2cc(-c3ccc(Cl)cc3)c3c(NN(C)C(N)=S)ncnc32)cc1 |
| InChI | InChI=1S/C21H19ClN6S/c1-13-3-9-16(10-4-13)28-11-17(14-5-7-15(22)8-6-14)18-19(24-12-25-20(18)28)26-27(2)21(23)29/h3-12H,1-2H3,(H2,23,29)(H,24,25,26) |
| InChIKey | RFYLDTBKCPHDPF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|