C25H19ClN4 — CID 4115346
N-benzyl-7-(4-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 4115346) has the molecular formula C25H19ClN4 and a molecular weight of 410.91 g/mol. Its IUPAC name is N-benzyl-7-(4-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-benzyl-7-(4-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4115346 |
| Molecular Formula | C25H19ClN4 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-benzyl-7-(4-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Clc1ccc(-n2cc(-c3ccccc3)c3c(NCc4ccccc4)ncnc32)cc1 |
| InChI | InChI=1S/C25H19ClN4/c26-20-11-13-21(14-12-20)30-16-22(19-9-5-2-6-10-19)23-24(28-17-29-25(23)30)27-15-18-7-3-1-4-8-18/h1-14,16-17H,15H2,(H,27,28,29) |
| InChIKey | HLGIABKXTVQVPZ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |