C27H23ClN6S — CID 21148495
1-benzyl-1-[[5-(4-chlorophenyl)-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]thiourea (PubChem CID 21148495) has the molecular formula C27H23ClN6S and a molecular weight of 499.04 g/mol. Its IUPAC name is 1-benzyl-1-[[5-(4-chlorophenyl)-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]thiourea.
| Compound Name | 1-benzyl-1-[[5-(4-chlorophenyl)-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]thiourea |
|---|---|
| PubChem CID | 21148495 |
| Molecular Formula | C27H23ClN6S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 1-benzyl-1-[[5-(4-chlorophenyl)-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]thiourea |
| SMILES | Cc1ccc(-n2cc(-c3ccc(Cl)cc3)c3c(NN(Cc4ccccc4)C(N)=S)ncnc32)cc1 |
| InChI | InChI=1S/C27H23ClN6S/c1-18-7-13-22(14-8-18)33-16-23(20-9-11-21(28)12-10-20)24-25(30-17-31-26(24)33)32-34(27(29)35)15-19-5-3-2-4-6-19/h2-14,16-17H,15H2,1H3,(H2,29,35)(H,30,31,32) |
| InChIKey | FHUBPUBEHVAXCF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|